On Target AGTR2_HUMAN 0.25490198/CHEMBL219840
For the given ligand test1, we have found in our database that, being scored 0.25490198, the most similar ligand is CHEMBL219840. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL219840 (Similar Ligand) |
|---|---|
| CCCc1ccc(C)c(C)c1 | O=C(N[C@@H](Cc1ccccc1)C(=O)O)c1cccc(Cn2ccnc2)c1 |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000001 00000000 00000000 00000000 00000900 00080840 08100000 40008800 00000000 00200000 00000000 00080008 00000000 02000000 00000000 00000001 00000100 08000000 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00000000 00000400 | 0000800a 00805a00 00100100 00010600 000810c1 00000000 10000000 02001004 00000980 00080cc0 08308008 4000b000 06009802 00000000 00000480 080c000c 10000000 02000000 00400808 00000201 80000100 18228e00 23000040 8140001c 00000800 c0000000 08000000 80000000 04000100 0046000b e00c4000 00000600 |