On Target AA2AR_HUMAN 0.2923077/CHEMBL496
For the given ligand test1, we have found in our database that, being scored 0.2923077, the most similar ligand is CHEMBL496. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL496 (Similar Ligand) |
|---|---|
| CCCc1ccc(C)c(C)c1 | Oc1c(Cl)cc(Cl)c(Cl)c1Cc1c(O)c(Cl)cc(Cl)c1Cl |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000001 00000000 00000000 00000000 00000900 00080840 08100000 40008800 00000000 00200000 00000000 00080008 00000000 02000000 00000000 00000001 00000100 08000000 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00000000 00000400 | 00008000 04000008 20000100 00010200 00000000 00000020 16000000 01000200 00000000 80480844 08000000 40008800 02000006 00000402 80000000 00002008 00000000 02000000 00000000 00020000 00000400 08000100 00000020 00400010 00002000 a0100a00 20100000 40000080 00000080 00020002 06000000 00020400 |