On Target NPFF1_HUMAN 0.28169015/CHEMBL575058
For the given ligand test1, we have found in our database that, being scored 0.28169015, the most similar ligand is CHEMBL575058. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL575058 (Similar Ligand) |
|---|---|
| CCCc1ccc(C)c(C)c1 | N=C(N)N/N=C(\c1ccccc1)c1ccc(Cl)c(Cl)c1 |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000001 00000000 00000000 00000000 00000900 00080840 08100000 40008800 00000000 00200000 00000000 00080008 00000000 02000000 00000000 00000001 00000100 08000000 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00000000 00000400 | 00008008 04000000 00000100 00010a00 00002000 00000000 04000000 81084000 00000100 000c0847 08000000 40008800 82000024 00000000 80000000 00080000 04000000 02000000 00000400 00000000 00080000 08000100 40040000 00400010 00002000 a0100800 40040100 40000000 000000a8 000e0402 40100800 00020400 |