On Target CCKAR_HUMAN 0.19298245/CHEMBL1210154
For the given ligand test1, we have found in our database that, being scored 0.19298245, the most similar ligand is CHEMBL1210154. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL1210154 (Similar Ligand) |
|---|---|
| CCCc1ccc(C)c(C)c1 | C/C(=N\OC(=O)Nc1ccccc1)c1cccc(-c2cccs2)c1 |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000001 00000000 00000000 00000000 00000900 00080840 08100000 40008800 00000000 00200000 00000000 00080008 00000000 02000000 00000000 00000001 00000100 08000000 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00000000 00000400 | 01012002 00000000 00000100 00050a00 00000041 00000000 00040082 08100008 00108308 00080841 08290204 40008384 10009010 00100000 00002040 0018001c 00468004 02801008 0c004200 00800000 40004090 48008c80 31002002 00400010 02000000 84000084 40000080 020002c5 0000c008 00060003 40080000 00c10480 |