On Target HRH4_HUMAN 0.37333333/CHEMBL489493
For the given ligand test1, we have found in our database that, being scored 0.37333333, the most similar ligand is CHEMBL489493. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL489493 (Similar Ligand) |
|---|---|
| CCCc1ccc(C)c(C)c1 | CC(C)(C)CC(=O)c1cccc(Cc2c[nH]cn2)c1 |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000001 00000000 00000000 00000000 00000900 00080840 08100000 40008800 00000000 00200000 00000000 00080008 00000000 02000000 00000000 00000001 00000100 08000000 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00000000 00000400 | 08000002 01000800 00000102 10010610 04000041 00080000 00002000 05001000 00400900 00080a40 28108000 40009a00 04008000 00300000 00020000 080c000c 00010000 02000001 00000000 40000001 00000100 08028600 21000000 00400014 00040000 80000200 00000000 40800000 00000084 00420002 c0000000 20000400 |