On Target 5HT2C_HUMAN 0.7/CHEMBL475643
For the given ligand test1, we have found in our database that, being scored 0.7, the most similar ligand is CHEMBL475643. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL475643 (Similar Ligand) |
|---|---|
| CCCc1ccc(C)c(C)c1 | Cc1ccc([C@H]2C[C@@H]2CN)cc1C.Cl |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000001 00000000 00000000 00000000 00000900 00080840 08100000 40008800 00000000 00200000 00000000 00080008 00000000 02000000 00000000 00000001 00000100 08000000 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00000000 00000400 | 00000000 01000200 00000102 00010600 00000001 00000000 00000000 00000000 00100900 000808c0 08100000 40018800 00000000 01200000 00000000 00080008 00000000 02000000 00000000 00000001 00000100 18000000 01000000 00400010 00000000 80000000 00000000 00000000 00000000 0006000a 00000000 00020400 |