On Target GRM4_HUMAN 0.20833333/CHEMBL4242079
For the given ligand test1, we have found in our database that, being scored 0.20833333, the most similar ligand is CHEMBL4242079. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL4242079 (Similar Ligand) |
|---|---|
| CCCc1ccc(C)c(C)c1 | c1cnc2c(Nc3ccc4c(C5CC5)n[nH]c4c3)n[nH]c2c1 |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000001 00000000 00000000 00000000 00000900 00080840 08100000 40008800 00000000 00200000 00000000 00080008 00000000 02000000 00000000 00000001 00000100 08000000 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00000000 00000400 | 00000003 00010008 20005100 00010220 010c0040 08000002 06800010 00000200 00002900 100c0840 88308004 40008050 08000823 01400000 00040040 000c600c 08240000 06001004 08600002 00260041 40080100 0c008008 25800800 00600010 00122002 80000000 2a160480 000000c0 0040800c 00460002 40040000 002044e0 |