On Target CCR2_HUMAN 0.3783784/CHEMBL3752640
For the given ligand test1, we have found in our database that, being scored 0.3783784, the most similar ligand is CHEMBL3752640. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL3752640 (Similar Ligand) |
|---|---|
| CCCc1ccc(C)c(C)c1 | Cc1ccc([C@]2(C)C[C@@H](C)CC=C2C(=O)O)cc1C |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000001 00000000 00000000 00000000 00000900 00080840 08100000 40008800 00000000 00200000 00000000 00080008 00000000 02000000 00000000 00000001 00000100 08000000 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00000000 00000400 | 00010000 01000000 00000102 00010200 00080001 00800000 00000081 08000402 01000900 00980840 08100000 40009800 04028028 00a00000 00000400 00080008 00000000 02100020 00612018 00000801 00000100 08000a80 01008040 00400010 00201800 80000400 00404000 80000000 00000002 00020002 24020000 00000400 |