On Target EDNRA_HUMAN 0.25547445/CHEMBL10905
For the given ligand Acetaminophen, we have found in our database that, being scored 0.25547445, the most similar ligand is CHEMBL10905. Check out the elaboration below.
| Acetaminophen (Given Ligand) | CHEMBL10905 (Similar Ligand) |
|---|---|
| CC(=O)Nc1ccc(O)cc1 | [K+].COc1ccc(cc1)C(=O)\C(=C(/C(=O)[O-])\c2ccc3OCOc3c2)\Cc4ccc(NC(=O)C)cc4 |
|
|
|
|
|
|
| 00004002 00000008 20000000 00000600 00000000 00000000 02000000 00000000 00000000 00000840 00280004 40008000 00008022 00100000 00000040 00000008 00040000 00000000 08000000 00020000 40100000 08000600 20002000 00000000 00000000 00000000 00040000 00000080 00008000 00060001 00000000 00000200 | 00004002 43000808 2000030b 40010600 00001041 00800000 82040081 00000400 01a00800 00b80840 48380004 40109000 0500c002 20308000 41040043 002a8008 08040400 02100000 08298018 00020a01 40140300 08020e80 2100a001 00400014 41001800 84004400 00522000 60010080 01408200 00060103 84002000 00090700 |