On Target CCR4_HUMAN 0.27433628/CHEMBL600196
For the given ligand Acetaminophen, we have found in our database that, being scored 0.27433628, the most similar ligand is CHEMBL600196. Check out the elaboration below.
| Acetaminophen (Given Ligand) | CHEMBL600196 (Similar Ligand) |
|---|---|
| CC(=O)Nc1ccc(O)cc1 | CCN1CCN(CC1)C2=C(C)c3c(O)cc(O)cc3OC2=O |
|
|
|
|
|
|
| 00004002 00000008 20000000 00000600 00000000 00000000 02000000 00000000 00000000 00000840 00280004 40008000 00008022 00100000 00000040 00000008 00040000 00000000 08000000 00020000 40100000 08000600 20002000 00000000 00000000 00000000 00040000 00000080 00008000 00060001 00000000 00000200 | 00004003 40202008 20080120 04410600 00050216 00400060 02000000 40000208 020a4000 40000a40 04200044 4060a000 40008422 00202480 000200c0 00000088 00240000 42000040 08800000 00821a02 40104000 28000008 20000028 02580002 08000000 80000000 00040030 08101080 0a00a000 09060800 00800000 00000200 |