On Target OPRM_HUMAN 0.46875/CHEMBL371268
For the given ligand Acetaminophen, we have found in our database that, being scored 0.46875, the most similar ligand is CHEMBL371268. Check out the elaboration below.
| Acetaminophen (Given Ligand) | CHEMBL371268 (Similar Ligand) |
|---|---|
| CC(=O)Nc1ccc(O)cc1 | CCC(=O)N(C1CCN(CCCCC[18F])CC1)c2ccccc2 |
|
|
|
|
|
|
| 00004002 00000008 20000000 00000600 00000000 00000000 02000000 00000000 00000000 00000840 00280004 40008000 00008022 00100000 00000040 00000008 00040000 00000000 08000000 00020000 40100000 08000600 20002000 00000000 00000000 00000000 00040000 00000080 00008000 00060001 00000000 00000200 | 00004002 01001400 00100000 00000600 20000800 00000000 00000000 20000000 00000000 000009e0 00280004 50019000 00008002 00100000 00020040 00000000 00040000 00000000 08000000 00000201 60100000 18080600 20002000 00100018 00000000 00000000 00000020 10000080 00008000 02060011 00000000 00002200 |