On Target NK1R_HUMAN 0.37974682/CHEMBL40262
For the given ligand Acetaminophen, we have found in our database that, being scored 0.37974682, the most similar ligand is CHEMBL40262. Check out the elaboration below.
| Acetaminophen (Given Ligand) | CHEMBL40262 (Similar Ligand) |
|---|---|
| CC(=O)Nc1ccc(O)cc1 | CN(C(=O)C(c1ccccc1)c2ccccc2)c3cc(cc(c3)C(F)(F)F)C(F)(F)F |
|
|
|
|
|
|
| 00004002 00000008 20000000 00000600 00000000 00000000 02000000 00000000 00000000 00000840 00280004 40008000 00008022 00100000 00000040 00000008 00040000 00000000 08000000 00020000 40100000 08000600 20002000 00000000 00000000 00000000 00040000 00000080 00008000 00060001 00000000 00000200 | 00004002 00080000 40100100 00010600 24000001 00000000 00000400 01000000 00000000 00080850 08280004 40009006 01008000 01100000 40020040 00000008 00040000 02000000 08000000 00000010 40100000 18200600 20002000 81400011 00040000 a0000000 00000000 d0000080 04408080 00060003 00102000 00000600 |