On Target OPRK_HUMAN 0.4117647/CHEMBL283552
For the given ligand Acetaminophen, we have found in our database that, being scored 0.4117647, the most similar ligand is CHEMBL283552. Check out the elaboration below.
| Acetaminophen (Given Ligand) | CHEMBL283552 (Similar Ligand) |
|---|---|
| CC(=O)Nc1ccc(O)cc1 | Oc1c(Br)cc(Br)cc1C(=O)Nc2cccc(c2)C(F)(F)F |
|
|
|
|
|
|
| 00004002 00000008 20000000 00000600 00000000 00000000 02000000 00000000 00000000 00000840 00280004 40008000 00008022 00100000 00000040 00000008 00040000 00000000 08000000 00020000 40100000 08000600 20002000 00000000 00000000 00000000 00040000 00000080 00008000 00060001 00000000 00000200 | 00004002 20008808 60100100 00010600 04000000 00020000 02000400 0a001400 40000000 00000850 10280004 c000c004 00008812 01100001 00000140 00002008 00040000 02000000 08000000 00020010 40100000 08028600 20012000 00400004 00040000 80000000 00420000 90000080 00408100 00062001 84140008 08000200 |