On Target NPY4R_HUMAN 0.19090909/CHEMBL2440199
For the given ligand Acetaminophen, we have found in our database that, being scored 0.19090909, the most similar ligand is CHEMBL2440199. Check out the elaboration below.
| Acetaminophen (Given Ligand) | CHEMBL2440199 (Similar Ligand) |
|---|---|
| CC(=O)Nc1ccc(O)cc1 | CC(C)C[C@H](NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)C)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N |
|
|
|
|
|
|
| 00004002 00000008 20000000 00000600 00000000 00000000 02000000 00000000 00000000 00000840 00280004 40008000 00008022 00100000 00000040 00000008 00040000 00000000 08000000 00020000 40100000 08000600 20002000 00000000 00000000 00000000 00040000 00000080 00008000 00060001 00000000 00000200 | 00010000 01003208 20100100 04010e00 00000000 00000000 02000000 2000200c 00200a80 000808c2 08300000 4003b000 06009012 00002001 80000000 00140008 00000000 02000000 00000008 00020201 00000100 38250620 00000003 83500018 00000800 80000000 40120000 10000000 0c000010 0006000b a0084000 00002600 |