On Target ACM1_HUMAN 0.37634408/CHEMBL1092460
For the given ligand Acetaminophen, we have found in our database that, being scored 0.37634408, the most similar ligand is CHEMBL1092460. Check out the elaboration below.
| Acetaminophen (Given Ligand) | CHEMBL1092460 (Similar Ligand) |
|---|---|
| CC(=O)Nc1ccc(O)cc1 | CCN1CCN(CC1)c2ccc(NC(=O)c3ccccc3OC)cc2Cl |
|
|
|
|
|
|
| 00004002 00000008 20000000 00000600 00000000 00000000 02000000 00000000 00000000 00000840 00280004 40008000 00008022 00100000 00000040 00000008 00040000 00000000 08000000 00020000 40100000 08000600 20002000 00000000 00000000 00000000 00040000 00000080 00008000 00060001 00000000 00000200 | 0000c002 00001808 20000128 05010600 00001000 00020100 0a000000 0a001400 00000000 00000a40 08280004 4000c800 02008806 00102001 01000041 00002008 00040000 12000000 08000000 00024000 40100000 28068700 20012020 02410006 00002000 80000400 00000800 80000080 08008300 00060001 84040000 00020200 |