On Target CNR1_HUMAN 0.49333334/CHEMBL200094
For the given ligand Acetaminophen, we have found in our database that, being scored 0.49333334, the most similar ligand is CHEMBL200094. Check out the elaboration below.
| Acetaminophen (Given Ligand) | CHEMBL200094 (Similar Ligand) |
|---|---|
| CC(=O)Nc1ccc(O)cc1 | CCCCC\C=C/C\C=C/C\C=C/C\C=C/CCCC(=O)Nc1ccc(OC)cc1 |
|
|
|
|
|
|
| 00004002 00000008 20000000 00000600 00000000 00000000 02000000 00000000 00000000 00000840 00280004 40008000 00008022 00100000 00000040 00000008 00040000 00000000 08000000 00020000 40100000 08000600 20002000 00000000 00000000 00000000 00040000 00000080 00008000 00060001 00000000 00000200 | 00014002 01000008 20100008 00000600 20001000 00002000 02000000 0000040a 00000000 001088c0 00280004 40019000 04028022 00100000 01020441 00000008 00040000 00000000 08012000 00020001 40100001 18000600 2000a000 00100810 00200000 00000000 00444000 90000080 00008200 00060001 24000000 00000200 |