On Target CLTR1_HUMAN 0.3181818/CHEMBL129866
For the given ligand Acetaminophen, we have found in our database that, being scored 0.3181818, the most similar ligand is CHEMBL129866. Check out the elaboration below.
| Acetaminophen (Given Ligand) | CHEMBL129866 (Similar Ligand) |
|---|---|
| CC(=O)Nc1ccc(O)cc1 | CC(C(=O)Nc1ccc(CC(=O)O)cc1)c2ccc3cc(OCc4ccc5ccccc5n4)ccc3c2 |
|
|
|
|
|
|
| 00004002 00000008 20000000 00000600 00000000 00000000 02000000 00000000 00000000 00000840 00280004 40008000 00008022 00100000 00000040 00000008 00040000 00000000 08000000 00020000 40100000 08000600 20002000 00000000 00000000 00000000 00040000 00000080 00008000 00060001 00000000 00000200 | 04004002 00000808 22124108 50010600 20041060 00004040 02000000 00000000 00000300 00080840 08280004 40009000 01808802 00518000 41060041 020c000c 0c048000 02800000 08200000 00020000 40100000 18208e28 a1802002 81c01111 00000000 80002000 00000040 00000080 04008204 00060003 40042000 00000600 |