On Target GRM1_HUMAN 0.3253012/CHEMBL254575
For the given ligand Acetaminophen, we have found in our database that, being scored 0.3253012, the most similar ligand is CHEMBL254575. Check out the elaboration below.
| Acetaminophen (Given Ligand) | CHEMBL254575 (Similar Ligand) |
|---|---|
| CC(=O)Nc1ccc(O)cc1 | COc1ccc(Nc2ncnc3ccc(OC)cc23)cc1 |
|
|
|
|
|
|
| 00004002 00000008 20000000 00000600 00000000 00000000 02000000 00000000 00000000 00000840 00280004 40008000 00008022 00100000 00000040 00000008 00040000 00000000 08000000 00020000 40100000 08000600 20002000 00000000 00000000 00000000 00040000 00000080 00008000 00060001 00000000 00000200 | 00000002 00000008 20000008 08080600 00041000 00004000 02088010 00000808 00002100 00000840 01300004 40009000 04000026 00400000 01000041 000c000c 00040000 10004000 0860000a 10220000 40000000 08040028 20804040 00000000 00002000 00000000 02040000 00000080 00008208 00460000 40000000 000000c0 |