On Target NPY5R_HUMAN 0.5151515/CHEMBL77355
For the given ligand Acetaminophen, we have found in our database that, being scored 0.5151515, the most similar ligand is CHEMBL77355. Check out the elaboration below.
| Acetaminophen (Given Ligand) | CHEMBL77355 (Similar Ligand) |
|---|---|
| CC(=O)Nc1ccc(O)cc1 | CC[C@@H](C)N(C)C(=O)Nc1ccc(Oc2ccccc2)cc1 |
|
|
|
|
|
|
| 00004002 00000008 20000000 00000600 00000000 00000000 02000000 00000000 00000000 00000840 00280004 40008000 00008022 00100000 00000040 00000008 00040000 00000000 08000000 00020000 40100000 08000600 20002000 00000000 00000000 00000000 00040000 00000080 00008000 00060001 00000000 00000200 | 00000006 00001008 20100008 00000e00 00001000 00000000 02000004 00002009 00000000 00000840 00280004 40008000 00009022 00100000 01000041 00000008 00040000 00400000 08002000 00020001 40400100 18010400 20022000 00000018 00110000 00000000 00040000 00200080 00008200 00060001 00000400 00004200 |