On Target NPFF1_HUMAN 0.28070176/CHEMBL3361420
For the given ligand Acetaminophen, we have found in our database that, being scored 0.28070176, the most similar ligand is CHEMBL3361420. Check out the elaboration below.
| Acetaminophen (Given Ligand) | CHEMBL3361420 (Similar Ligand) |
|---|---|
| CC(=O)Nc1ccc(O)cc1 | COc1cccc(NC2(CNC(=O)CNC(=N)N)CCN(Cc3ccccc3)CC2)c1 |
|
|
|
|
|
|
| 00004002 00000008 20000000 00000600 00000000 00000000 02000000 00000000 00000000 00000840 00280004 40008000 00008022 00100000 00000040 00000008 00040000 00000000 08000000 00020000 40100000 08000600 20002000 00000000 00000000 00000000 00040000 00000080 00008000 00060001 00000000 00000200 | 00004002 81003408 20100128 04010e00 20001000 00000000 02000000 22003008 00200440 00000be2 00200004 5003a000 0400a802 08002000 01020441 00100008 00050090 02000000 08000000 00022601 60100000 38058600 20000003 0250001a 00000000 c0000000 40000000 90000080 08008310 00060011 20044000 00020200 |