On Target NPY1R_HUMAN 0.3043478/CHEMBL2046861
For the given ligand Acetaminophen, we have found in our database that, being scored 0.3043478, the most similar ligand is CHEMBL2046861. Check out the elaboration below.
| Acetaminophen (Given Ligand) | CHEMBL2046861 (Similar Ligand) |
|---|---|
| CC(=O)Nc1ccc(O)cc1 | C[C@@H]1C[C@@H]2[C@H](C1)[C@]2(N3CCN(CC3)c4ccccc4)c5ccc(O)cc5 |
|
|
|
|
|
|
| 00004002 00000008 20000000 00000600 00000000 00000000 02000000 00000000 00000000 00000840 00280004 40008000 00008022 00100000 00000040 00000008 00040000 00000000 08000000 00020000 40100000 08000600 20002000 00000000 00000000 00000000 00040000 00000080 00008000 00060001 00000000 00000200 | 00004002 01000008 20100122 04010600 00000000 00000000 02000000 22001000 00000800 00090ac0 08300004 40018000 00000802 01202000 00000440 00000008 00040000 02000000 0a002000 00020201 40100100 38008010 20000021 02500012 00000000 c0000000 00320000 90000080 08008102 01060002 00060000 00000600 |