On Target 5HT2B_HUMAN 0.44615385/CHEMBL57135
For the given ligand Acetaminophen, we have found in our database that, being scored 0.44615385, the most similar ligand is CHEMBL57135. Check out the elaboration below.
| Acetaminophen (Given Ligand) | CHEMBL57135 (Similar Ligand) |
|---|---|
| CC(=O)Nc1ccc(O)cc1 | CCN(CC)c1ccc(NC(=O)Nc2ccnc3ccccc23)cc1 |
|
|
|
|
|
|
| 00004002 00000008 20000000 00000600 00000000 00000000 02000000 00000000 00000000 00000840 00280004 40008000 00008022 00100000 00000040 00000008 00040000 00000000 08000000 00020000 40100000 08000600 20002000 00000000 00000000 00000000 00040000 00000080 00008000 00060001 00000000 00000200 | 00004006 00001000 00004000 00000e40 00040000 00000000 00008000 00002001 00000000 00000840 00280004 40008000 00008802 00500000 00000040 00040004 00040000 00000000 08200000 00000000 40100100 08048408 20826000 80000020 00100000 00000000 00008000 00000080 00008000 00060001 00040000 00004240 |