On Target 5HT7R_HUMAN 0.54901963/CHEMBL3262404
For the given ligand Acetaminophen, we have found in our database that, being scored 0.54901963, the most similar ligand is CHEMBL3262404. Check out the elaboration below.
| Acetaminophen (Given Ligand) | CHEMBL3262404 (Similar Ligand) |
|---|---|
| CC(=O)Nc1ccc(O)cc1 | Oc1cccc(NCCN2CCN(CC2)c3ccccc3)c1 |
|
|
|
|
|
|
| 00004002 00000008 20000000 00000600 00000000 00000000 02000000 00000000 00000000 00000840 00280004 40008000 00008022 00100000 00000040 00000008 00040000 00000000 08000000 00020000 40100000 08000600 20002000 00000000 00000000 00000000 00040000 00000080 00008000 00060001 00000000 00000200 | 00004002 80000008 20000020 04000600 00000000 00000000 02000000 00000000 00000000 00000a40 00200004 40008000 00000002 00002000 00000040 00000008 00040080 00000000 08000000 00022400 40100000 28000000 20000022 02000002 00000000 00000000 00000000 00000080 08008000 00060000 00000000 00000200 |