On Target ADRB3_HUMAN 0.27631578/CHEMBL273028
For the given ligand test, we have found in our database that, being scored 0.27631578, the most similar ligand is CHEMBL273028. Check out the elaboration below.
| test (Given Ligand) | CHEMBL273028 (Similar Ligand) |
|---|---|
| c3ccc(c1ccccc1c2ccccc2)cc3 | Cc1cc(ccc1c2ccc(CCNC[C@H](O)c3cccc(Cl)c3)cc2)C(=O)O |
|
|
|
|
|
|
| 00002000 00000001 00000100 00010200 00000000 00000000 00000000 00000000 00000000 00000840 00000080 40008000 00000000 00200000 20000000 00000000 00020000 02000000 04000000 00000000 00000000 08000000 10000000 00400000 00000000 80000000 00000000 00000040 00004000 00020000 00000000 00000000 | 0000a000 14000801 00100100 40050600 00000081 00004000 04000000 00000000 00000180 00080840 08200000 40008800 02008006 00200000 a0080000 08080008 10020000 02000000 04000000 50000200 00000000 18220b20 12000000 81480014 00002000 80000000 00000000 00000040 04004000 00060002 c0000000 00022600 |