On Target DRD4_HUMAN 0.27631578/CHEMBL184551
For the given ligand test, we have found in our database that, being scored 0.27631578, the most similar ligand is CHEMBL184551. Check out the elaboration below.
| test (Given Ligand) | CHEMBL184551 (Similar Ligand) |
|---|---|
| c3ccc(c1ccccc1c2ccccc2)cc3 | O=Cc1ccccc1c2ccc(cc2)C(=O)NC3CCN(Cc4ccccc4)C3 |
|
|
|
|
|
|
| 00002000 00000001 00000100 00010200 00000000 00000000 00000000 00000000 00000000 00000840 00000080 40008000 00000000 00200000 20000000 00000000 00020000 02000000 04000000 00000000 00000000 08000000 10000000 00400000 00000000 80000000 00000000 00000040 00004000 00020000 00000000 00000000 | 08002000 00003c01 00100100 44010600 00000000 00008010 00000000 22001008 00400100 000109e0 00200000 40008000 80008802 00202000 20000400 00000000 00020000 02000000 04000000 10000201 00000000 380a8600 10000000 0240001c 00000000 c0000000 00000000 90000040 08004100 00060011 a0040000 00000200 |