On Target TSHR_HUMAN 0.12264151/CHEMBL3908443
For the given ligand test, we have found in our database that, being scored 0.12264151, the most similar ligand is CHEMBL3908443. Check out the elaboration below.
| test (Given Ligand) | CHEMBL3908443 (Similar Ligand) |
|---|---|
| c3ccc(c1ccccc1c2ccccc2)cc3 | CCCCCC(=O)Nc1ccc2N(C(=O)C)C(C)(C)CC(C)(c3ccccc3)c2c1 |
|
|
|
|
|
|
| 00002000 00000001 00000100 00010200 00000000 00000000 00000000 00000000 00000000 00000840 00000080 40008000 00000000 00200000 20000000 00000000 00020000 02000000 04000000 00000000 00000000 08000000 10000000 00400000 00000000 80000000 00000000 00000040 00004000 00020000 00000000 00000000 | 08014002 01001200 40100102 00010600 24000020 00082040 01000000 21000000 00400800 000808d0 08380024 40019000 0400800a 00300800 00020040 00040000 00048000 02000001 08002008 00000201 44100100 18040610 20002000 00500018 00040000 a1000000 00000010 50001080 00488080 0006000b 00000080 20000600 |