On Target NPFF1_HUMAN 0.22580644/CHEMBL573738
For the given ligand test, we have found in our database that, being scored 0.22580644, the most similar ligand is CHEMBL573738. Check out the elaboration below.
| test (Given Ligand) | CHEMBL573738 (Similar Ligand) |
|---|---|
| c3ccc(c1ccccc1c2ccccc2)cc3 | Cc1ccccc1c2oc(\C=N\NC(=N)N)cc2 |
|
|
|
|
|
|
| 00002000 00000001 00000100 00010200 00000000 00000000 00000000 00000000 00000000 00000840 00000080 40008000 00000000 00200000 20000000 00000000 00020000 02000000 04000000 00000000 00000000 08000000 10000000 00400000 00000000 80000000 00000000 00000040 00004000 00020000 00000000 00000000 | 00c82108 00200001 00080100 00014a00 00002000 00004000 00000000 c1ac4000 01004100 08000843 00000020 40108800 c0000400 00200080 20000020 20080000 00024000 42000800 04021600 50008000 012c0080 08020020 50040000 00480000 00000000 80000800 44000110 08000040 00004028 000e0000 40110840 08000000 |