On Target NPY2R_HUMAN 0.39759037/CHEMBL437487
For the given ligand CHEMBL1779871, we have found in our database that, being scored 0.39759037, the most similar ligand is CHEMBL437487. Check out the elaboration below.
| CHEMBL1779871 (Given Ligand) | CHEMBL437487 (Similar Ligand) |
|---|---|
| Cc4cccc(C#Cc3ccc2C(=O)N(C1CCCC1)CCc2n3)c4 | CSc1ncccc1C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc1cnc[nH]1)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc1ccc(O)cc1)C(N)=O)[C@@H](C)O |
|
|
|
|
|
|
| 1400020a 01829800 00104922 50090690 0044b021 01008000 00004000 2200100c 00000180 00080ad1 09218004 40818000 80008882 00200000 01020480 0204000c 00228200 0a000024 00200000 00000211 c0820001 18a48e40 20804001 8350011c 00241004 c0040000 48004040 90001800 04400104 01060043 a0000000 a000a600 | 14038002 0180fe08 20124120 05912e10 040412c0 00200020 02006020 2200300c 00600b80 000b0bc2 29308004 7003b800 1e009812 00102801 911a0400 001c000c 14020000 0e000005 00a00018 40020201 e0000d00 382d8e20 23800083 9358001d 00043801 d0000200 48120000 90000100 0c400116 0046001b e0084000 a0812660 |