On Target AA2BR_HUMAN 0.375/CHEMBL469136
For the given ligand CHEMBL1779871, we have found in our database that, being scored 0.375, the most similar ligand is CHEMBL469136. Check out the elaboration below.
| CHEMBL1779871 (Given Ligand) | CHEMBL469136 (Similar Ligand) |
|---|---|
| Cc4cccc(C#Cc3ccc2C(=O)N(C1CCCC1)CCc2n3)c4 | Cn1c(=O)c2[nH]c(-c3ccc(COC(=O)N4CCc5ccccc5C4)cc3)cc2n(C)c1=O |
|
|
|
|
|
|
| 1400020a 01829800 00104922 50090690 0044b021 01008000 00004000 2200100c 00000180 00080ad1 09218004 40818000 80008882 00200000 01020480 0204000c 00228200 0a000024 00200000 00000211 c0820001 18a48e40 20804001 8350011c 00241004 c0040000 48004040 90001800 04400104 01060043 a0000000 a000a600 | 0100202a 00c01800 00100100 92050600 000c0060 0000e040 00008002 02081004 16400380 d00818e0 0d20800c 60018000 00009882 00e11000 003e04c0 0a1e000c 08820200 0288a424 04600880 10600202 c0020080 38228c70 31804041 8170001c 00040000 c0002002 20008040 80240050 04004304 00460c03 e00c0a00 000006a0 |