On Target CCR4_HUMAN 0.45909092/CHEMBL2435852
For the given ligand CHEMBL1779871, we have found in our database that, being scored 0.45909092, the most similar ligand is CHEMBL2435852. Check out the elaboration below.
| CHEMBL1779871 (Given Ligand) | CHEMBL2435852 (Similar Ligand) |
|---|---|
| Cc4cccc(C#Cc3ccc2C(=O)N(C1CCCC1)CCc2n3)c4 | Cc1nc(Oc2ccc(C(=O)O)cc2)ccc1CN1CCC(N2C(=O)N(C3CCOCC3)C[C@H]2c2ccccc2)CC1 |
|
|
|
|
|
|
| 1400020a 01829800 00104922 50090690 0044b021 01008000 00004000 2200100c 00000180 00080ad1 09218004 40818000 80008882 00200000 01020480 0204000c 00228200 0a000024 00200000 00000211 c0820001 18a48e40 20804001 8350011c 00241004 c0040000 48004040 90001800 04400104 01060043 a0000000 a000a600 | 10000002 0180bc18 2010410b 14010f10 800c1020 00004100 06044404 2240700c 00002180 000809f0 09200004 50018000 00009882 00282000 21020501 021c000c 10224008 02002004 00e02040 00020201 c1420120 383b8e20 21800081 8350001c 00050403 c0000000 08624040 90202000 0c400324 00060013 f0140400 84002600 |