On Target GASR_HUMAN 0.44554454/CHEMBL282732
For the given ligand CHEMBL1779871, we have found in our database that, being scored 0.44554454, the most similar ligand is CHEMBL282732. Check out the elaboration below.
| CHEMBL1779871 (Given Ligand) | CHEMBL282732 (Similar Ligand) |
|---|---|
| Cc4cccc(C#Cc3ccc2C(=O)N(C1CCCC1)CCc2n3)c4 | O=C(CCC(NC(=O)c1cc(Cl)cc(Cl)c1)C(=O)N1CCC2(CCCC2)CC1)N[C@H](Cc1ccccn1)C(=O)O |
|
|
|
|
|
|
| 1400020a 01829800 00104922 50090690 0044b021 01008000 00004000 2200100c 00000180 00080ad1 09218004 40818000 80008882 00200000 01020480 0204000c 00228200 0a000024 00200000 00000211 c0820001 18a48e40 20804001 8350011c 00241004 c0040000 48004040 90001800 04400104 01060043 a0000000 a000a600 | 0403800a 09007800 00104120 14010600 000400a0 00000020 04000000 2200100c 00200880 000b0ac8 08308004 5083b800 06008816 00002400 810a0400 020c000c 10000000 0e000000 00602018 00000201 40000100 38268f30 238000c1 8350001c 00003800 c0000000 00000040 90000000 0c000104 01860803 a0064000 20822600 |