On Target MC4R_HUMAN 0.48314607/CHEMBL463047
For the given ligand CHEMBL1779871, we have found in our database that, being scored 0.48314607, the most similar ligand is CHEMBL463047. Check out the elaboration below.
| CHEMBL1779871 (Given Ligand) | CHEMBL463047 (Similar Ligand) |
|---|---|
| Cc4cccc(C#Cc3ccc2C(=O)N(C1CCCC1)CCc2n3)c4 | CCC[C@H]1C(=O)N([C@@H](Cc2ccc3ccccc3c2)C(=O)NC)CCN1C(=O)[C@@H](Cc1ccc(F)cc1)NC(=O)c1cccnc1 |
|
|
|
|
|
|
| 1400020a 01829800 00104922 50090690 0044b021 01008000 00004000 2200100c 00000180 00080ad1 09218004 40818000 80008882 00200000 01020480 0204000c 00228200 0a000024 00200000 00000211 c0820001 18a48e40 20804001 8350011c 00241004 c0040000 48004040 90001800 04400104 01060043 a0000000 a000a600 | 10018002 0180ba00 00104100 06010610 00041000 00000010 00004000 2200100c 00000880 000908c0 09300004 4001b000 06008802 00003001 80000400 00040004 00020000 02000084 00200008 00100201 c0000100 38248e08 20800023 8350001c 00040800 c0000000 08000000 90000001 0c400100 0006800b a0004000 80002600 |