On Target ACM4_HUMAN 0.46524063/CHEMBL4062718
For the given ligand CHEMBL1779871, we have found in our database that, being scored 0.46524063, the most similar ligand is CHEMBL4062718. Check out the elaboration below.
| CHEMBL1779871 (Given Ligand) | CHEMBL4062718 (Similar Ligand) |
|---|---|
| Cc4cccc(C#Cc3ccc2C(=O)N(C1CCCC1)CCc2n3)c4 | N#Cc1cnc2ccc(F)cc2c1N1CCC(C(=O)N2CCc3ccccc3C2)CC1 |
|
|
|
|
|
|
| 1400020a 01829800 00104922 50090690 0044b021 01008000 00004000 2200100c 00000180 00080ad1 09218004 40818000 80008882 00200000 01020480 0204000c 00228200 0a000024 00200000 00000211 c0820001 18a48e40 20804001 8350011c 00241004 c0040000 48004040 90001800 04400104 01060043 a0000000 a000a600 | 0002400a 01801000 00104100 12010610 21041020 00002070 00008000 22001004 00200080 008908c0 08200004 50039000 04008882 00601000 000204c0 00040007 00440200 02000024 08a00000 00200201 c0120000 18248608 20804500 83500018 00040000 c0000000 0800c400 90001081 04408100 00068403 20040000 00802640 |