On Target 5HT5A_HUMAN 0.56647396/CHEMBL129476
For the given ligand CHEMBL1779871, we have found in our database that, being scored 0.56647396, the most similar ligand is CHEMBL129476. Check out the elaboration below.
| CHEMBL1779871 (Given Ligand) | CHEMBL129476 (Similar Ligand) |
|---|---|
| Cc4cccc(C#Cc3ccc2C(=O)N(C1CCCC1)CCc2n3)c4 | Cn1c2c(c3ccccc31)CN(CCCC(=O)c1ccccc1)CC2 |
|
|
|
|
|
|
| 1400020a 01829800 00104922 50090690 0044b021 01008000 00004000 2200100c 00000180 00080ad1 09218004 40818000 80008882 00200000 01020480 0204000c 00228200 0a000024 00200000 00000211 c0820001 18a48e40 20804001 8350011c 00241004 c0040000 48004040 90001800 04400104 01060043 a0000000 a000a600 | 1402000a 01005800 00100122 10010610 00041020 00000000 00004000 22001000 00100880 00080ac0 09308004 40819000 04009882 00608000 01020440 02040004 00020208 8a800024 00200000 00000201 40020100 18228a18 20804000 83500414 00045000 c0000000 18004000 90000000 04000104 00060042 a00c8200 a0802620 |