On Target NK1R_HUMAN 0.50898206/CHEMBL295122
For the given ligand CHEMBL1779871, we have found in our database that, being scored 0.50898206, the most similar ligand is CHEMBL295122. Check out the elaboration below.
| CHEMBL1779871 (Given Ligand) | CHEMBL295122 (Similar Ligand) |
|---|---|
| Cc4cccc(C#Cc3ccc2C(=O)N(C1CCCC1)CCc2n3)c4 | Cc1cc(C)cc(C(=O)N2CC[C@H](NCc3cnc4ccccc4c3)C[C@H]2Cc2ccccc2)c1 |
|
|
|
|
|
|
| 1400020a 01829800 00104922 50090690 0044b021 01008000 00004000 2200100c 00000180 00080ad1 09218004 40818000 80008882 00200000 01020480 0204000c 00228200 0a000024 00200000 00000211 c0820001 18a48e40 20804001 8350011c 00241004 c0040000 48004040 90001800 04400104 01060043 a0000000 a000a600 | 10000002 01009c00 00104102 00010610 00041001 00000000 10004000 22001004 00100880 000809e0 09300004 50018000 00008802 00600000 00000440 0804000c 00020000 02000004 00202000 00000201 40000100 182e8e18 20800000 8150001c 00040000 c0000000 08000000 90000000 04400102 00060013 a0060000 80002600 |