On Target CXCR3_HUMAN 0.47906977/CHEMBL395745
For the given ligand CHEMBL1779871, we have found in our database that, being scored 0.47906977, the most similar ligand is CHEMBL395745. Check out the elaboration below.
| CHEMBL1779871 (Given Ligand) | CHEMBL395745 (Similar Ligand) |
|---|---|
| Cc4cccc(C#Cc3ccc2C(=O)N(C1CCCC1)CCc2n3)c4 | CC#Cc1ccc(-n2c([C@@H](C)N(Cc3cccnc3)C(=O)Cc3ccc(C(F)(F)F)cc3)nc3ccccc3c2=O)cc1 |
|
|
|
|
|
|
| 1400020a 01829800 00104922 50090690 0044b021 01008000 00004000 2200100c 00000180 00080ad1 09218004 40818000 80008882 00200000 01020480 0204000c 00228200 0a000024 00200000 00000211 c0820001 18a48e40 20804001 8350011c 00241004 c0040000 48004040 90001800 04400104 01060043 a0000000 a000a600 | 1000020a 01828a00 00104900 10090e10 004c3060 00104020 0000dc02 02003001 06100180 400808f0 0921800c 40819800 81009802 01600200 400604c0 020c0104 08020008 02008006 00600000 00020a01 c0000081 18a18e38 21800041 83700418 00140004 c0080040 28008100 90040000 06404104 0046000b 60742000 e0106680 |