On Target NPY4R_HUMAN 0.3497537/CHEMBL4641831
For the given ligand CHEMBL1779871, we have found in our database that, being scored 0.3497537, the most similar ligand is CHEMBL4641831. Check out the elaboration below.
| CHEMBL1779871 (Given Ligand) | CHEMBL4641831 (Similar Ligand) |
|---|---|
| Cc4cccc(C#Cc3ccc2C(=O)N(C1CCCC1)CCc2n3)c4 | CC(C)C[C@H](NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H](N)Cc1c[nH]c2ccccc12)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc1ccc(O)cc1)C(N)=O |
|
|
|
|
|
|
| 1400020a 01829800 00104922 50090690 0044b021 01008000 00004000 2200100c 00000180 00080ad1 09218004 40818000 80008882 00200000 01020480 0204000c 00228200 0a000024 00200000 00000211 c0820001 18a48e40 20804001 8350011c 00241004 c0040000 48004040 90001800 04400104 01060043 a0000000 a000a600 | 00010002 01003a08 20100100 45810e10 00041200 00000000 02002000 2000200c 00600a80 000908c2 08300004 4003b000 1e009812 00402801 80000040 0014000c 00000000 02000000 00200408 00020201 40000100 38258628 20800003 83500018 00043800 80000000 48120000 10000000 0c000010 0006000b a00c4200 00002620 |