On Target GRM1_HUMAN 0.3888889/CHEMBL233709
For the given ligand CHEMBL1779871, we have found in our database that, being scored 0.3888889, the most similar ligand is CHEMBL233709. Check out the elaboration below.
| CHEMBL1779871 (Given Ligand) | CHEMBL233709 (Similar Ligand) |
|---|---|
| Cc4cccc(C#Cc3ccc2C(=O)N(C1CCCC1)CCc2n3)c4 | CC(=O)NCCCCNC(=O)c1[nH]cc(C(=O)OC2CC3CCC2C3)c1C |
|
|
|
|
|
|
| 1400020a 01829800 00104922 50090690 0044b021 01008000 00004000 2200100c 00000180 00080ad1 09218004 40818000 80008882 00200000 01020480 0204000c 00228200 0a000024 00200000 00000211 c0820001 18a48e40 20804001 8350011c 00241004 c0040000 48004040 90001800 04400104 01060043 a0000000 a000a600 | 00000002 01809800 00100100 10010f10 04080030 00108000 10900000 22003005 10600100 00000c90 40290004 40028800 00008802 08b18000 00020480 0a0c110c 00820001 02000006 02612000 40000201 80020020 18058e00 21802000 0040001c 00140400 40000000 08084000 90000000 04000305 01060003 e0020204 02004220 |