On Target TSHR_HUMAN 0.3622449/CHEMBL3983689
For the given ligand CHEMBL1779871, we have found in our database that, being scored 0.3622449, the most similar ligand is CHEMBL3983689. Check out the elaboration below.
| CHEMBL1779871 (Given Ligand) | CHEMBL3983689 (Similar Ligand) |
|---|---|
| Cc4cccc(C#Cc3ccc2C(=O)N(C1CCCC1)CCc2n3)c4 | CC(=O)N1c2ccc(NC(=O)c3ccccn3)cc2C(C)(c2ccccc2)CC1(C)C |
|
|
|
|
|
|
| 1400020a 01829800 00104922 50090690 0044b021 01008000 00004000 2200100c 00000180 00080ad1 09218004 40818000 80008882 00200000 01020480 0204000c 00228200 0a000024 00200000 00000211 c0820001 18a48e40 20804001 8350011c 00241004 c0040000 48004040 90001800 04400104 01060043 a0000000 a000a600 | 08004002 01201a00 40104102 10010e00 24060020 00182040 01000000 23001001 00400800 000808d0 08390024 4000c000 00008802 00300800 00020040 02040104 00048000 02000001 08200008 00000201 44100100 18068600 20812000 0040001c 00140000 a1000001 00000050 d0001080 00488184 0006000b 80040080 20004600 |