On Target 5HT1B_HUMAN 0.5106383/CHEMBL3104092
For the given ligand CHEMBL1779871, we have found in our database that, being scored 0.5106383, the most similar ligand is CHEMBL3104092. Check out the elaboration below.
| CHEMBL1779871 (Given Ligand) | CHEMBL3104092 (Similar Ligand) |
|---|---|
| Cc4cccc(C#Cc3ccc2C(=O)N(C1CCCC1)CCc2n3)c4 | CN1CCc2c(c3cccc4c3n2Cc2ccccc2C4)C1 |
|
|
|
|
|
|
| 1400020a 01829800 00104922 50090690 0044b021 01008000 00004000 2200100c 00000180 00080ad1 09218004 40818000 80008882 00200000 01020480 0204000c 00228200 0a000024 00200000 00000211 c0820001 18a48e40 20804001 8350011c 00241004 c0040000 48004040 90001800 04400104 01060043 a0000000 a000a600 | 1c00000a 00005a00 00100120 10010618 00041021 00000000 10006400 03001000 80500100 10080ad0 09208004 40818800 800018a2 00608000 01020440 02040084 00030208 8a800024 00280400 00010200 44020000 18208c18 20804001 83500414 00045000 e0000000 18000040 d0000000 06000184 0006004b 200c8200 a0000620 |