On Target NPY1R_HUMAN 0.39906102/CHEMBL124343
For the given ligand CHEMBL1779871, we have found in our database that, being scored 0.39906102, the most similar ligand is CHEMBL124343. Check out the elaboration below.
| CHEMBL1779871 (Given Ligand) | CHEMBL124343 (Similar Ligand) |
|---|---|
| Cc4cccc(C#Cc3ccc2C(=O)N(C1CCCC1)CCc2n3)c4 | Cn1c(COc2ccc(Cl)cc2)c(C(=O)CN2CCC(N3CCCCC3)CC2)c2ccccc21 |
|
|
|
|
|
|
| 1400020a 01829800 00104922 50090690 0044b021 01008000 00004000 2200100c 00000180 00080ad1 09218004 40818000 80008882 00200000 01020480 0204000c 00228200 0a000024 00200000 00000211 c0820001 18a48e40 20804001 8350011c 00241004 c0040000 48004040 90001800 04400104 01060043 a0000000 a000a600 | 04008002 01801c08 22120108 51010610 00045020 0000c440 02002000 20020004 00400380 000909e0 08200004 5001a800 12808806 00618000 81020041 020e000c 04008200 82800404 00200400 00020201 c0000800 18268378 a0804003 91d0111c 00042000 c8002220 08100000 10000000 04000205 00060052 c0044200 00022620 |