On Target GRM2_HUMAN 0.42777777/CHEMBL3909273
For the given ligand CHEMBL1779871, we have found in our database that, being scored 0.42777777, the most similar ligand is CHEMBL3909273. Check out the elaboration below.
| CHEMBL1779871 (Given Ligand) | CHEMBL3909273 (Similar Ligand) |
|---|---|
| Cc4cccc(C#Cc3ccc2C(=O)N(C1CCCC1)CCc2n3)c4 | CC1CCC(c2cc(C(N)=O)nc3cc(CN4C(=O)CCC4=O)ccc23)CC1 |
|
|
|
|
|
|
| 1400020a 01829800 00104922 50090690 0044b021 01008000 00004000 2200100c 00000180 00080ad1 09218004 40818000 80008882 00200000 01020480 0204000c 00228200 0a000024 00200000 00000211 c0820001 18a48e40 20804001 8350011c 00241004 c0040000 48004040 90001800 04400104 01060043 a0000000 a000a600 | 00020002 01801800 00104102 50010600 00040021 00000010 00000000 22001001 00000800 00080ac0 08390004 40009000 8c008802 00708000 00020440 0a0c000c 00000008 02000000 02202400 00000201 c0020100 18028608 21802000 8040001c 00106000 c0000000 08000040 90000000 00000106 00060003 a0068000 00804620 |