On Target CNR2_HUMAN 0.6158192/CHEMBL1950330
For the given ligand CHEMBL1779871, we have found in our database that, being scored 0.6158192, the most similar ligand is CHEMBL1950330. Check out the elaboration below.
| CHEMBL1779871 (Given Ligand) | CHEMBL1950330 (Similar Ligand) |
|---|---|
| Cc4cccc(C#Cc3ccc2C(=O)N(C1CCCC1)CCc2n3)c4 | C=CCn1c2c(c3cc(C(=O)N4CCC(C)CC4)ccc31)CN(CC1CC1)CC2 |
|
|
|
|
|
|
| 1400020a 01829800 00104922 50090690 0044b021 01008000 00004000 2200100c 00000180 00080ad1 09218004 40818000 80008882 00200000 01020480 0204000c 00228200 0a000024 00200000 00000211 c0820001 18a48e40 20804001 8350011c 00241004 c0040000 48004040 90001800 04400104 01060043 a0000000 a000a600 | 1400000a 0100d800 00100120 50010610 00041021 00000000 00084000 22001400 10000180 10080ac0 09208004 50818000 80009882 01608002 01020440 02040004 00020208 8a800124 00210000 00000301 40021000 18268e18 20804001 8350041c 00045000 c0000000 18004040 90000000 04400104 00060043 a40c8200 a0002620 |