On Target 5HT4R_HUMAN 0.49162012/CHEMBL4202791
For the given ligand CHEMBL1779871, we have found in our database that, being scored 0.49162012, the most similar ligand is CHEMBL4202791. Check out the elaboration below.
| CHEMBL1779871 (Given Ligand) | CHEMBL4202791 (Similar Ligand) |
|---|---|
| Cc4cccc(C#Cc3ccc2C(=O)N(C1CCCC1)CCc2n3)c4 | COCCCN1CCC(CNC(=O)c2cccn3cc(C(C)C)nc23)CC1 |
|
|
|
|
|
|
| 1400020a 01829800 00104922 50090690 0044b021 01008000 00004000 2200100c 00000180 00080ad1 09218004 40818000 80008882 00200000 01020480 0204000c 00228200 0a000024 00200000 00000211 c0820001 18a48e40 20804001 8350011c 00241004 c0040000 48004040 90001800 04400104 01060043 a0000000 a000a600 | 1000000a 01809800 00104100 10010610 04041060 00004000 1000e000 22001000 00600100 000800d0 21208004 50838800 00008882 00900000 000604c0 020c000c 08220000 02000004 00a00400 40000201 c0000000 18048e20 21800080 0050011c 00040001 40000200 08008000 90000004 00400304 00460001 e0040000 a0002280 |