On Target CCR2_HUMAN 0.6331361/CHEMBL2314058
For the given ligand CHEMBL1779871, we have found in our database that, being scored 0.6331361, the most similar ligand is CHEMBL2314058. Check out the elaboration below.
| CHEMBL1779871 (Given Ligand) | CHEMBL2314058 (Similar Ligand) |
|---|---|
| Cc4cccc(C#Cc3ccc2C(=O)N(C1CCCC1)CCc2n3)c4 | O=C(N1CCc2ncc(C(F)(F)F)cc2C1)[C@@]12CCC[C@@H]1C[C@@H](NC1CCCCCC1)C2 |
|
|
|
|
|
|
| 1400020a 01829800 00104922 50090690 0044b021 01008000 00004000 2200100c 00000180 00080ad1 09218004 40818000 80008882 00200000 01020480 0204000c 00228200 0a000024 00200000 00000211 c0820001 18a48e40 20804001 8350011c 00241004 c0040000 48004040 90001800 04400104 01060043 a0000000 a000a600 | 1403000a 01829000 00104120 10000610 00041020 00000000 10004c00 2200100c 00200180 000802d0 09208004 40831802 0400889a 02200000 01020480 0204000c 00020220 0a000024 00202000 00000201 c0020000 18208e30 20804000 81500018 00041002 c0000000 08004140 90001000 04400104 01060003 20120000 a0802600 |