On Target CXCR2_HUMAN 0.34449762/CHEMBL3609013
For the given ligand CHEMBL1779871, we have found in our database that, being scored 0.34449762, the most similar ligand is CHEMBL3609013. Check out the elaboration below.
| CHEMBL1779871 (Given Ligand) | CHEMBL3609013 (Similar Ligand) |
|---|---|
| Cc4cccc(C#Cc3ccc2C(=O)N(C1CCCC1)CCc2n3)c4 | O=C(Nc1ccc(F)cc1)c1ccc(N(Cc2ccccc2)Cc2ccc(B(O)O)cn2)nc1 |
|
|
|
|
|
|
| 1400020a 01829800 00104922 50090690 0044b021 01008000 00004000 2200100c 00000180 00080ad1 09218004 40818000 80008882 00200000 01020480 0204000c 00228200 0a000024 00200000 00000211 c0820001 18a48e40 20804001 8350011c 00241004 c0040000 48004040 90001800 04400104 01060043 a0000000 a000a600 | 10004002 00a08800 00104182 92010e18 01061820 00100010 00004000 02003001 00000180 20000848 01298004 6000c000 40008802 04109000 00020d40 021c0104 00042000 03004006 08200000 00a00200 c0100000 0c048e00 21812800 0060000c 00160000 c0000081 0c0000c0 90000081 0060811c 00068801 80041000 80004220 |