On Target EDNRA_HUMAN 0.521978/CHEMBL323951
For the given ligand sinomenine, we have found in our database that, being scored 0.521978, the most similar ligand is CHEMBL323951. Check out the elaboration below.
| sinomenine (Given Ligand) | CHEMBL323951 (Similar Ligand) |
|---|---|
| CO/C4=C/C2C3Cc1ccc(OC)c(O)c1[C@]2(CCN3C)CC4=O | C/C=C\C(C)(C)C[C@H]1[C@H](C(=O)O)[C@@H](c2ccc3c(c2)OCO3)CN1CC(=O)N(CCCC)CCCC |
|
|
|
|
|
|
| 00010000 4b000208 2010010a 00110700 00081020 c0000002 070c0180 20000603 01000880 001888ca 08300000 5181d040 8402c01a 20a00000 03000421 020ca008 20800200 82000060 00492008 00020201 00000100 18200290 0100c000 81540010 00200800 80002001 04524000 90000180 04004202 0006c40a 2c020000 00012600 | 00030000 43001208 2010010a 04010600 00181000 c0000010 02040000 20000400 10200880 001808c0 48300000 4001b000 0e02c00a 20a02000 81000401 002c8008 00004000 02000000 00c82018 00020201 00040300 38240e10 010080c1 83500018 40001801 80000000 00524000 b0000000 0d000202 0006000b 24024000 00812e00 |