On Target GRM6_HUMAN 0.221519/CHEMBL2381641
For the given ligand sinomenine, we have found in our database that, being scored 0.221519, the most similar ligand is CHEMBL2381641. Check out the elaboration below.
| sinomenine (Given Ligand) | CHEMBL2381641 (Similar Ligand) |
|---|---|
| CO/C4=C/C2C3Cc1ccc(OC)c(O)c1[C@]2(CCN3C)CC4=O | C=C1C[C@@](N)(C(=O)O)[C@@H]2[C@@H](C(=O)O)[C@H]12 |
|
|
|
|
|
|
| 00010000 4b000208 2010010a 00110700 00081020 c0000002 070c0180 20000603 01000880 001888ca 08300000 5181d040 8402c01a 20a00000 03000421 020ca008 20800200 82000060 00492008 00020201 00000100 18200290 0100c000 81540010 00200800 80002001 04524000 90000180 04004202 0006c40a 2c020000 00012600 | 00030000 81000000 00000000 00000400 00180000 00000000 00080000 00000400 10000000 00128088 00000000 40013000 04008038 03800000 00000400 00080008 00000000 00000000 02412000 00000001 00000000 10000a10 03000000 00000010 00000000 00000000 00000000 80000000 00000000 81040000 24020000 00000000 |