On Target ADRB2_HUMAN 0.45299146/CHEMBL1714856
For the given ligand sinomenine, we have found in our database that, being scored 0.45299146, the most similar ligand is CHEMBL1714856. Check out the elaboration below.
| sinomenine (Given Ligand) | CHEMBL1714856 (Similar Ligand) |
|---|---|
| CO/C4=C/C2C3Cc1ccc(OC)c(O)c1[C@]2(CCN3C)CC4=O | COC(=O)C1=C(c2cccc(OCc3ccccc3)c2)C[C@@H]2CC[C@H]1N2C(=O)NCc1cccc(F)c1 |
|
|
|
|
|
|
| 00010000 4b000208 2010010a 00110700 00081020 c0000002 070c0180 20000603 01000880 001888ca 08300000 5181d040 8402c01a 20a00000 03000421 020ca008 20800200 82000060 00492008 00020201 00000100 18200290 0100c000 81540010 00200800 80002001 04524000 90000180 04004202 0006c40a 2c020000 00012600 | 04010010 4b809208 2010030a 02010f00 00081040 40004810 82180184 3a003402 01800900 015828c8 49300000 51119000 0c82990a 20a11080 01000423 020c0108 20a24400 02000541 40c9a05a 00820201 80000100 18158eb0 010080a0 00d01018 01213083 80002401 00486000 d0010501 00400302 0006850b 6c0e0000 82002710 |