On Target HRH2_HUMAN 0.4311377/CHEMBL490632
For the given ligand sinomenine, we have found in our database that, being scored 0.4311377, the most similar ligand is CHEMBL490632. Check out the elaboration below.
| sinomenine (Given Ligand) | CHEMBL490632 (Similar Ligand) |
|---|---|
| CO/C4=C/C2C3Cc1ccc(OC)c(O)c1[C@]2(CCN3C)CC4=O | COc1c(OCCF)cccc1C(=O)C1CCN(CCc2ccc(C)cc2)CC1 |
|
|
|
|
|
|
| 00010000 4b000208 2010010a 00110700 00081020 c0000002 070c0180 20000603 01000880 001888ca 08300000 5181d040 8402c01a 20a00000 03000421 020ca008 20800200 82000060 00492008 00020201 00000100 18200290 0100c000 81540010 00200800 80002001 04524000 90000180 04004202 0006c40a 2c020000 00012600 | 06020000 43000808 2010010a 00210600 00001000 40020000 02000000 21000200 00100980 000808c0 08300000 50019840 0480c002 20200080 01004001 2208a008 00000000 02000000 00080400 00020201 00000100 18220200 00000000 81500414 00000000 c0000000 00000800 10000000 04000300 0006400a 80000000 00802600 |